C13H18N2O3 — CID 66455924
6-(3,5-dimethylcyclohexyl)oxypyrazine-2-carboxylic acid (PubChem CID 66455924) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(3,5-dimethylcyclohexyl)oxypyrazine-2-carboxylic acid.
| Compound Name | 6-(3,5-dimethylcyclohexyl)oxypyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 66455924 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6-(3,5-dimethylcyclohexyl)oxypyrazine-2-carboxylic acid |
| SMILES | CC1CC(C)CC(Oc2cncc(C(=O)O)n2)C1 |
| InChI | InChI=1S/C13H18N2O3/c1-8-3-9(2)5-10(4-8)18-12-7-14-6-11(15-12)13(16)17/h6-10H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | HNWSMRRDKDONNC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |