C12H9Cl2N3O2 — CID 66457541
methyl 6-(3,4-dichloroanilino)pyrazine-2-carboxylate (PubChem CID 66457541) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is methyl 6-(3,4-dichloroanilino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(3,4-dichloroanilino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457541 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | methyl 6-(3,4-dichloroanilino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-19-12(18)10-5-15-6-11(17-10)16-7-2-3-8(13)9(14)4-7/h2-6H,1H3,(H,16,17) |
| InChIKey | HUGFCGZZEDRRDY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |