C14H14N4O3 — CID 66456378
methyl 6-(4-acetamidoanilino)pyrazine-2-carboxylate (PubChem CID 66456378) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 6-(4-acetamidoanilino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(4-acetamidoanilino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66456378 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 6-(4-acetamidoanilino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(Nc2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C14H14N4O3/c1-9(19)16-10-3-5-11(6-4-10)17-13-8-15-7-12(18-13)14(20)21-2/h3-8H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | TTZOWJTUGJIKIW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |