C12H22N4 — CID 66457590
N-ethyl-6-(ethylaminomethyl)-N-propan-2-ylpyrazin-2-amine (PubChem CID 66457590) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-ethyl-6-(ethylaminomethyl)-N-propan-2-ylpyrazin-2-amine.
| Compound Name | N-ethyl-6-(ethylaminomethyl)-N-propan-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 66457590 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-ethyl-6-(ethylaminomethyl)-N-propan-2-ylpyrazin-2-amine |
| SMILES | CCNCc1cncc(N(CC)C(C)C)n1 |
| InChI | InChI=1S/C12H22N4/c1-5-13-7-11-8-14-9-12(15-11)16(6-2)10(3)4/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | BXTBVKNBXGRKPT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |