C11H19N3O — CID 66466147
[6-[propan-2-yl(propyl)amino]pyrazin-2-yl]methanol (PubChem CID 66466147) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is [6-[propan-2-yl(propyl)amino]pyrazin-2-yl]methanol.
| Compound Name | [6-[propan-2-yl(propyl)amino]pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 66466147 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [6-[propan-2-yl(propyl)amino]pyrazin-2-yl]methanol |
| SMILES | CCCN(c1cncc(CO)n1)C(C)C |
| InChI | InChI=1S/C11H19N3O/c1-4-5-14(9(2)3)11-7-12-6-10(8-15)13-11/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | YQZUZYUWNSDZKD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |