C12H17N3O3 — CID 66457647
6-[ethyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylic acid (PubChem CID 66457647) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-[ethyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[ethyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 66457647 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-[ethyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylic acid |
| SMILES | CCN(CC1CCCO1)c1cncc(C(=O)O)n1 |
| InChI | InChI=1S/C12H17N3O3/c1-2-15(8-9-4-3-5-18-9)11-7-13-6-10(14-11)12(16)17/h6-7,9H,2-5,8H2,1H3,(H,16,17) |
| InChIKey | QCQPWJVBJJQVDZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |