C9H9ClN2O3 — CID 66462207
(2S)-2-[(3-chloropyridine-4-carbonyl)amino]propanoic acid (PubChem CID 66462207) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is (2S)-2-[(3-chloropyridine-4-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(3-chloropyridine-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 66462207 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | (2S)-2-[(3-chloropyridine-4-carbonyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccncc1Cl)C(=O)O |
| InChI | InChI=1S/C9H9ClN2O3/c1-5(9(14)15)12-8(13)6-2-3-11-4-7(6)10/h2-5H,1H3,(H,12,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | JPQFURJDSMAFDI-YFKPBYRVSA-N |
| XLogP | 0.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |