C9H9ClN2O4 — CID 80750607
(2R)-2-[(3-chloropyridine-4-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 80750607) has the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. Its IUPAC name is (2R)-2-[(3-chloropyridine-4-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(3-chloropyridine-4-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80750607 |
| Molecular Formula | C9H9ClN2O4 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (2R)-2-[(3-chloropyridine-4-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | O=C(N[C@H](CO)C(=O)O)c1ccncc1Cl |
| InChI | InChI=1S/C9H9ClN2O4/c10-6-3-11-2-1-5(6)8(14)12-7(4-13)9(15)16/h1-3,7,13H,4H2,(H,12,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | VQPPATMZJHPKOQ-SSDOTTSWSA-N |
| XLogP | -0.09 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |