C17H22ClNO2 — CID 66470754
1-[1-(2-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 66470754) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 66470754 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CC(c1ccccc1Cl)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C17H22ClNO2/c1-11(13-7-3-4-8-14(13)18)19-15-9-5-2-6-12(15)10-16(19)17(20)21/h3-4,7-8,11-12,15-16H,2,5-6,9-10H2,1H3,(H,20,21) |
| InChIKey | ACKNHWVJILDXJD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |