C18H24BrNO3 — CID 122041053
1-[1-(2-bromo-4-methoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122041053) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is 1-[1-(2-bromo-4-methoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[1-(2-bromo-4-methoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122041053 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-[1-(2-bromo-4-methoxyphenyl)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | COc1ccc(C(C)N2C(C(=O)O)CC3CCCCC32)c(Br)c1 |
| InChI | InChI=1S/C18H24BrNO3/c1-11(14-8-7-13(23-2)10-15(14)19)20-16-6-4-3-5-12(16)9-17(20)18(21)22/h7-8,10-12,16-17H,3-6,9H2,1-2H3,(H,21,22) |
| InChIKey | PUCOGNUAZRADNX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |