C11H15NO3S2 — CID 664712
2-(2-methoxyphenyl)-3-methylsulfonyl-1,3-thiazolidine (PubChem CID 664712) has the molecular formula C11H15NO3S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3-methylsulfonyl-1,3-thiazolidine.
| Compound Name | 2-(2-methoxyphenyl)-3-methylsulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 664712 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(2-methoxyphenyl)-3-methylsulfonyl-1,3-thiazolidine |
| SMILES | COc1ccccc1C1SCCN1S(C)(=O)=O |
| InChI | InChI=1S/C11H15NO3S2/c1-15-10-6-4-3-5-9(10)11-12(7-8-16-11)17(2,13)14/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | YUWVIPZRATXDHE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |