C16H17NO3S2 — CID 4174260
3-(benzenesulfonyl)-2-(2-methoxyphenyl)-1,3-thiazolidine (PubChem CID 4174260) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-(2-methoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(benzenesulfonyl)-2-(2-methoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 4174260 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2-(2-methoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1ccccc1C1SCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3S2/c1-20-15-10-6-5-9-14(15)16-17(11-12-21-16)22(18,19)13-7-3-2-4-8-13/h2-10,16H,11-12H2,1H3 |
| InChIKey | YUBRXPLLZQONCZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |