C17H18FNO4S2 — CID 656153
2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 656153) has the molecular formula C17H18FNO4S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 656153 |
| Molecular Formula | C17H18FNO4S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C17H18FNO4S2/c1-22-15-8-3-12(11-16(15)23-2)17-19(9-10-24-17)25(20,21)14-6-4-13(18)5-7-14/h3-8,11,17H,9-10H2,1-2H3 |
| InChIKey | ZLJBJOPJFWZHQN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |