C13H19NO4S — CID 2767989
4-[(3,4-dimethoxyphenyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 2767989) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 2767989 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | COc1ccc(CN2CCS(=O)(=O)CC2)cc1OC |
| InChI | InChI=1S/C13H19NO4S/c1-17-12-4-3-11(9-13(12)18-2)10-14-5-7-19(15,16)8-6-14/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | SOAYGVGBEYRRFQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |