C14H21NO2 — CID 66472713
N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline (PubChem CID 66472713) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline |
|---|---|
| PubChem CID | 66472713 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)CCC1OCCCO1 |
| InChI | InChI=1S/C14H21NO2/c1-12-6-3-4-7-13(12)15(2)9-8-14-16-10-5-11-17-14/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | ITCPYGJAKYYNKA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |