About N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline
N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline (PubChem CID 66472713) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline.
Molecular Properties
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline |
| PubChem CID | 66472713 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)CCC1OCCCO1 |
| InChI | InChI=1S/C14H21NO2/c1-12-6-3-4-7-13(12)15(2)9-8-14-16-10-5-11-17-14/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | ITCPYGJAKYYNKA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline?
The IUPAC name of N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline (CID 66472713) is N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline.
What is the SMILES notation for N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline?
The canonical SMILES for N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline is Cc1ccccc1N(C)CCC1OCCCO1.
What is the InChIKey of N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline?
The InChIKey is ITCPYGJAKYYNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-12-6-3-4-7-13(12)15(2)9-8-14-16-10-5-11-17-14/h3-4,6-7,14H,5,8-11H2,1-2H3.
What are the key properties of N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline?
N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline has a molecular weight of 235.33 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-dioxan-2-yl)ethyl]-N,2-dimethylaniline is sourced from PubChem (CID 66472713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).