C11H20O3S — CID 66473359
2-[2-(oxan-4-ylsulfanyl)ethyl]-1,3-dioxane (PubChem CID 66473359) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 2-[2-(oxan-4-ylsulfanyl)ethyl]-1,3-dioxane.
| Compound Name | 2-[2-(oxan-4-ylsulfanyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 66473359 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[2-(oxan-4-ylsulfanyl)ethyl]-1,3-dioxane |
| SMILES | C1COC(CCSC2CCOCC2)OC1 |
| InChI | InChI=1S/C11H20O3S/c1-5-13-11(14-6-1)4-9-15-10-2-7-12-8-3-10/h10-11H,1-9H2 |
| InChIKey | NJFXXKGTIXWNDA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |