C13H20BrNO — CID 66480993
2-amino-1-(4-bromo-3-methylphenyl)-4-methylpentan-1-ol (PubChem CID 66480993) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-amino-1-(4-bromo-3-methylphenyl)-4-methylpentan-1-ol.
| Compound Name | 2-amino-1-(4-bromo-3-methylphenyl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 66480993 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-amino-1-(4-bromo-3-methylphenyl)-4-methylpentan-1-ol |
| SMILES | Cc1cc(C(O)C(N)CC(C)C)ccc1Br |
| InChI | InChI=1S/C13H20BrNO/c1-8(2)6-12(15)13(16)10-4-5-11(14)9(3)7-10/h4-5,7-8,12-13,16H,6,15H2,1-3H3 |
| InChIKey | OCAHQHGGGVCXFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |