C15H25NO — CID 114078248
2-amino-4-methyl-1-(2,4,5-trimethylphenyl)pentan-1-ol (PubChem CID 114078248) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-amino-4-methyl-1-(2,4,5-trimethylphenyl)pentan-1-ol.
| Compound Name | 2-amino-4-methyl-1-(2,4,5-trimethylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 114078248 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-amino-4-methyl-1-(2,4,5-trimethylphenyl)pentan-1-ol |
| SMILES | Cc1cc(C)c(C(O)C(N)CC(C)C)cc1C |
| InChI | InChI=1S/C15H25NO/c1-9(2)6-14(16)15(17)13-8-11(4)10(3)7-12(13)5/h7-9,14-15,17H,6,16H2,1-5H3 |
| InChIKey | NVRGYPARTJGSOZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |