C16H26O2 — CID 103459784
3-ethyl-1-(2,4,5-trimethylphenyl)pentane-1,2-diol (PubChem CID 103459784) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-ethyl-1-(2,4,5-trimethylphenyl)pentane-1,2-diol.
| Compound Name | 3-ethyl-1-(2,4,5-trimethylphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103459784 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-ethyl-1-(2,4,5-trimethylphenyl)pentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C16H26O2/c1-6-13(7-2)15(17)16(18)14-9-11(4)10(3)8-12(14)5/h8-9,13,15-18H,6-7H2,1-5H3 |
| InChIKey | JDGJPKHWUPATOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |