C14H20F2O2 — CID 107513057
1-(2,3-difluoro-4-methylphenyl)-3-ethylpentane-1,2-diol (PubChem CID 107513057) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 107513057 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C14H20F2O2/c1-4-9(5-2)13(17)14(18)10-7-6-8(3)11(15)12(10)16/h6-7,9,13-14,17-18H,4-5H2,1-3H3 |
| InChIKey | DUNUDHHIZAPCPV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |