C15H24O2 — CID 103459685
1-(2,4-dimethylphenyl)-3-ethylpentane-1,2-diol (PubChem CID 103459685) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-ethylpentane-1,2-diol.
| Compound Name | 1-(2,4-dimethylphenyl)-3-ethylpentane-1,2-diol |
|---|---|
| PubChem CID | 103459685 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-ethylpentane-1,2-diol |
| SMILES | CCC(CC)C(O)C(O)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H24O2/c1-5-12(6-2)14(16)15(17)13-8-7-10(3)9-11(13)4/h7-9,12,14-17H,5-6H2,1-4H3 |
| InChIKey | YSHFUQALBZHKDA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |