C14H24N2 — CID 116945487
2-ethyl-1-(2,4,5-trimethylphenyl)propane-1,3-diamine (PubChem CID 116945487) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-ethyl-1-(2,4,5-trimethylphenyl)propane-1,3-diamine.
| Compound Name | 2-ethyl-1-(2,4,5-trimethylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116945487 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-ethyl-1-(2,4,5-trimethylphenyl)propane-1,3-diamine |
| SMILES | CCC(CN)C(N)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C14H24N2/c1-5-12(8-15)14(16)13-7-10(3)9(2)6-11(13)4/h6-7,12,14H,5,8,15-16H2,1-4H3 |
| InChIKey | PJNCYDXILGKARA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |