C16H23BrN2 — CID 66481295
[2-(4-bromo-3-methylphenyl)-1-cyclopropylpiperidin-3-yl]methanamine (PubChem CID 66481295) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is [2-(4-bromo-3-methylphenyl)-1-cyclopropylpiperidin-3-yl]methanamine.
| Compound Name | [2-(4-bromo-3-methylphenyl)-1-cyclopropylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 66481295 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [2-(4-bromo-3-methylphenyl)-1-cyclopropylpiperidin-3-yl]methanamine |
| SMILES | Cc1cc(C2C(CN)CCCN2C2CC2)ccc1Br |
| InChI | InChI=1S/C16H23BrN2/c1-11-9-12(4-7-15(11)17)16-13(10-18)3-2-8-19(16)14-5-6-14/h4,7,9,13-14,16H,2-3,5-6,8,10,18H2,1H3 |
| InChIKey | LHBKNUJHEIYBSO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |