C15H20BrClN2 — CID 66159366
[2-(2-bromo-5-chlorophenyl)-1-cyclopropylpiperidin-3-yl]methanamine (PubChem CID 66159366) has the molecular formula C15H20BrClN2 and a molecular weight of 343.70 g/mol. Its IUPAC name is [2-(2-bromo-5-chlorophenyl)-1-cyclopropylpiperidin-3-yl]methanamine.
| Compound Name | [2-(2-bromo-5-chlorophenyl)-1-cyclopropylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 66159366 |
| Molecular Formula | C15H20BrClN2 |
| Molecular Weight | 343.70 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [2-(2-bromo-5-chlorophenyl)-1-cyclopropylpiperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(C2CC2)C1c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H20BrClN2/c16-14-6-3-11(17)8-13(14)15-10(9-18)2-1-7-19(15)12-4-5-12/h3,6,8,10,12,15H,1-2,4-5,7,9,18H2 |
| InChIKey | ZZNVJWBQJBOKTE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |