C14H14N4O2 — CID 66482445
3-(4-hydroxybut-1-ynyl)-N-(1-methylpyrazol-4-yl)pyridine-4-carboxamide (PubChem CID 66482445) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(1-methylpyrazol-4-yl)pyridine-4-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(1-methylpyrazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66482445 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(1-methylpyrazol-4-yl)pyridine-4-carboxamide |
| SMILES | Cn1cc(NC(=O)c2ccncc2C#CCCO)cn1 |
| InChI | InChI=1S/C14H14N4O2/c1-18-10-12(9-16-18)17-14(20)13-5-6-15-8-11(13)4-2-3-7-19/h5-6,8-10,19H,3,7H2,1H3,(H,17,20) |
| InChIKey | QPFAUBZAJCOKQA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|