C21H21N3O3S2 — CID 66485255
N-(1,1-dioxothiolan-2-yl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide (PubChem CID 66485255) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-2-yl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-2-yl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 66485255 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-(1,1-dioxothiolan-2-yl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)NC1CCCS1(=O)=O |
| InChI | InChI=1S/C21H21N3O3S2/c25-17(22-18-12-7-13-29(18,26)27)14-28-21-23-19(15-8-3-1-4-9-15)20(24-21)16-10-5-2-6-11-16/h1-6,8-11,18H,7,12-14H2,(H,22,25)(H,23,24) |
| InChIKey | VLZNVUGJFREZGM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |