C14H16N3O+ — CID 66486239
[4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-trimethylazanium (PubChem CID 66486239) has the molecular formula C14H16N3O+ and a molecular weight of 242.30 g/mol. Its IUPAC name is [4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-trimethylazanium.
| Compound Name | [4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-trimethylazanium |
|---|---|
| PubChem CID | 66486239 |
| Molecular Formula | C14H16N3O+ |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-trimethylazanium |
| SMILES | Cc1ccc(-c2nc(C#N)c([N+](C)(C)C)o2)cc1 |
| InChI | InChI=1S/C14H16N3O/c1-10-5-7-11(8-6-10)13-16-12(9-15)14(18-13)17(2,3)4/h5-8H,1-4H3/q+1 |
| InChIKey | ISTAPPSHZOXDOD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|