C18H14N4O2 — CID 15892647
N-(4-cyano-2-phenyl-1,3-oxazol-5-yl)-4-methylbenzohydrazide (PubChem CID 15892647) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is N-(4-cyano-2-phenyl-1,3-oxazol-5-yl)-4-methylbenzohydrazide.
| Compound Name | N-(4-cyano-2-phenyl-1,3-oxazol-5-yl)-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 15892647 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-(4-cyano-2-phenyl-1,3-oxazol-5-yl)-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)N(N)c2oc(-c3ccccc3)nc2C#N)cc1 |
| InChI | InChI=1S/C18H14N4O2/c1-12-7-9-14(10-8-12)17(23)22(20)18-15(11-19)21-16(24-18)13-5-3-2-4-6-13/h2-10H,20H2,1H3 |
| InChIKey | RHQBRWNIHDQWPT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|