C27H22N4O3 — CID 45129246
N-[4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide (PubChem CID 45129246) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | N-[4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 45129246 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[4-cyano-2-(4-methylphenyl)-1,3-oxazol-5-yl]-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(C)cc2)c2oc(-c3ccc(C)cc3)nc2C#N)cc1 |
| InChI | InChI=1S/C27H22N4O3/c1-18-4-10-21(11-5-18)25-30-24(16-28)27(34-25)31(26(32)22-12-6-19(2)7-13-22)29-17-20-8-14-23(33-3)15-9-20/h4-15,17H,1-3H3/b29-17+ |
| InChIKey | NQIXMROSZSCJPO-STBIYBPSSA-N |
| XLogP | 5.52 |
| TPSA | 91.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|