C17H10N2O2 — CID 143438347
2-(4-formylphenyl)-5-phenyl-1,3-oxazole-4-carbonitrile (PubChem CID 143438347) has the molecular formula C17H10N2O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(4-formylphenyl)-5-phenyl-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(4-formylphenyl)-5-phenyl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 143438347 |
| Molecular Formula | C17H10N2O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-(4-formylphenyl)-5-phenyl-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccc(C=O)cc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C17H10N2O2/c18-10-15-16(13-4-2-1-3-5-13)21-17(19-15)14-8-6-12(11-20)7-9-14/h1-9,11H |
| InChIKey | XSLNKFSKAUCVJH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|