C19H22N2O — CID 66486373
(E)-N-[(4-aminophenyl)methyl]-N-methyl-5-phenylpent-4-enamide (PubChem CID 66486373) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (E)-N-[(4-aminophenyl)methyl]-N-methyl-5-phenylpent-4-enamide.
| Compound Name | (E)-N-[(4-aminophenyl)methyl]-N-methyl-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 66486373 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (E)-N-[(4-aminophenyl)methyl]-N-methyl-5-phenylpent-4-enamide |
| SMILES | CN(Cc1ccc(N)cc1)C(=O)CC/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-21(15-17-11-13-18(20)14-12-17)19(22)10-6-5-9-16-7-3-2-4-8-16/h2-5,7-9,11-14H,6,10,15,20H2,1H3/b9-5+ |
| InChIKey | WVRJKYZSEKXJOS-WEVVVXLNSA-N |
| XLogP | 3.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|