C24H31N3O — CID 8544482
N-methyl-N-[(4-methylphenyl)methyl]-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetamide (PubChem CID 8544482) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N-methyl-N-[(4-methylphenyl)methyl]-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetamide.
| Compound Name | N-methyl-N-[(4-methylphenyl)methyl]-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8544482 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-methyl-N-[(4-methylphenyl)methyl]-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)CN2CCN(C/C=C/c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O/c1-21-10-12-23(13-11-21)19-25(2)24(28)20-27-17-15-26(16-18-27)14-6-9-22-7-4-3-5-8-22/h3-13H,14-20H2,1-2H3/b9-6+ |
| InChIKey | CVWPBENJOLCDJU-RMKNXTFCSA-N |
| XLogP | 3.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |