C13H12N6O — CID 66487601
4-methoxy-3-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 66487601) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-methoxy-3-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-methoxy-3-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 66487601 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-methoxy-3-(5-pyrazin-2-yl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | COc1ccc(N)cc1-c1n[nH]c(-c2cnccn2)n1 |
| InChI | InChI=1S/C13H12N6O/c1-20-11-3-2-8(14)6-9(11)12-17-13(19-18-12)10-7-15-4-5-16-10/h2-7H,14H2,1H3,(H,17,18,19) |
| InChIKey | OKSNAHUOVKFOQP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|