C21H21N7O3S2 — CID 66488327
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[3-[4-(dimethylamino)phenyl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 66488327) has the molecular formula C21H21N7O3S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[3-[4-(dimethylamino)phenyl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[3-[4-(dimethylamino)phenyl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 66488327 |
| Molecular Formula | C21H21N7O3S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[3-[4-(dimethylamino)phenyl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CN(C)c1ccc(C2CC(c3ccc([N+](=O)[O-])cc3)=NN2C(=O)CSc2nnc(N)s2)cc1 |
| InChI | InChI=1S/C21H21N7O3S2/c1-26(2)15-7-5-14(6-8-15)18-11-17(13-3-9-16(10-4-13)28(30)31)25-27(18)19(29)12-32-21-24-23-20(22)33-21/h3-10,18H,11-12H2,1-2H3,(H2,22,23) |
| InChIKey | BWNVUUTTXKYNHG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|