C11H10N4OS — CID 66489204
(6-oxo-5-phenyl-1H-pyrimidin-2-yl)thiourea (PubChem CID 66489204) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is (6-oxo-5-phenyl-1H-pyrimidin-2-yl)thiourea.
| Compound Name | (6-oxo-5-phenyl-1H-pyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 66489204 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (6-oxo-5-phenyl-1H-pyrimidin-2-yl)thiourea |
| SMILES | NC(=S)Nc1ncc(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H10N4OS/c12-10(17)15-11-13-6-8(9(16)14-11)7-4-2-1-3-5-7/h1-6H,(H4,12,13,14,15,16,17) |
| InChIKey | CEMKZWOYKFNUMH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|