C23H27N5O3S — CID 118591502
1-(2-methylphenyl)-3-[5-[4-[(3-methylsulfinylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea (PubChem CID 118591502) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[5-[4-[(3-methylsulfinylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[5-[4-[(3-methylsulfinylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 118591502 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-(2-methylphenyl)-3-[5-[4-[(3-methylsulfinylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ncc(-c2ccc(CNCCCS(C)=O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H27N5O3S/c1-16-6-3-4-7-20(16)26-23(30)28-22-25-15-19(21(29)27-22)18-10-8-17(9-11-18)14-24-12-5-13-32(2)31/h3-4,6-11,15,24H,5,12-14H2,1-2H3,(H3,25,26,27,28,29,30) |
| InChIKey | OPOMZXZXRVUKKQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|