C23H26ClN5O2S — CID 118591468
1-[5-[3-chloro-4-[(3-sulfanylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]urea (PubChem CID 118591468) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is 1-[5-[3-chloro-4-[(3-sulfanylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[5-[3-chloro-4-[(3-sulfanylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 118591468 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-[5-[3-chloro-4-[(3-sulfanylpropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)Nc2ncc(-c3ccc(CNCCCS)c(Cl)c3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H26ClN5O2S/c1-15-3-5-16(6-4-15)12-27-23(31)29-22-26-14-19(21(30)28-22)17-7-8-18(20(24)11-17)13-25-9-2-10-32/h3-8,11,14,25,32H,2,9-10,12-13H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | VYKVIZWMHKQRNS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|