C23H26F2N8O2 — CID 118591572
1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4-difluoro-5-methylphenyl)urea (PubChem CID 118591572) has the molecular formula C23H26F2N8O2 and a molecular weight of 484.51 g/mol. Its IUPAC name is 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4-difluoro-5-methylphenyl)urea.
| Compound Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4-difluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 118591572 |
| Molecular Formula | C23H26F2N8O2 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4-difluoro-5-methylphenyl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ncc(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)[nH]2)c(F)cc1F |
| InChI | InChI=1S/C23H26F2N8O2/c1-13-9-19(18(25)10-17(13)24)31-23(35)33-22-30-12-16(20(34)32-22)15-5-3-14(4-6-15)11-28-7-2-8-29-21(26)27/h3-6,9-10,12,28H,2,7-8,11H2,1H3,(H4,26,27,29)(H3,30,31,32,33,34,35) |
| InChIKey | BSSWEWDLUBWSDG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|