C33H50ClN9O3 — CID 158018518
1-[2-(3-aminopropoxy)-4-chlorophenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 158018518) has the molecular formula C33H50ClN9O3 and a molecular weight of 656.28 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-4-chlorophenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 1-[2-(3-aminopropoxy)-4-chlorophenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 158018518 |
| Molecular Formula | C33H50ClN9O3 |
| Molecular Weight | 656.28 g/mol |
| Exact Mass | 655.37 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-4-chlorophenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)NC(=O)Nc1ccc(Cl)cc1OCCCN.CC(C)(C)c1ncc(-c2ccc(CNCCCN=C(N)N)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H28N6O.C14H22ClN3O2/c1-19(2,3)17-24-12-15(16(26)25-17)14-7-5-13(6-8-14)11-22-9-4-10-23-18(20)21;1-14(2,3)18-13(19)17-11-6-5-10(15)9-12(11)20-8-4-7-16/h5-8,12,22H,4,9-11H2,1-3H3,(H4,20,21,23)(H,24,25,26);5-6,9H,4,7-8,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | FFTUFGMNKUFOJO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|