C26H30F3N9O2 — CID 66582229
1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[1-[(2,4,5-trifluorophenyl)methyl]azetidin-3-yl]urea (PubChem CID 66582229) has the molecular formula C26H30F3N9O2 and a molecular weight of 557.58 g/mol. Its IUPAC name is 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[1-[(2,4,5-trifluorophenyl)methyl]azetidin-3-yl]urea.
| Compound Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[1-[(2,4,5-trifluorophenyl)methyl]azetidin-3-yl]urea |
|---|---|
| PubChem CID | 66582229 |
| Molecular Formula | C26H30F3N9O2 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[1-[(2,4,5-trifluorophenyl)methyl]azetidin-3-yl]urea |
| SMILES | NC(N)=NCCCNCc1ccc(-c2cnc(NC(=O)NC3CN(Cc4cc(F)c(F)cc4F)C3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H30F3N9O2/c27-20-9-22(29)21(28)8-17(20)12-38-13-18(14-38)35-26(40)37-25-34-11-19(23(39)36-25)16-4-2-15(3-5-16)10-32-6-1-7-33-24(30)31/h2-5,8-9,11,18,32H,1,6-7,10,12-14H2,(H4,30,31,33)(H3,34,35,36,37,39,40) |
| InChIKey | FHCPDNCMUQMYPQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|