C22H27N9O2 — CID 118591686
1-[5-[6-[[3-(diaminomethylideneamino)propylamino]methyl]-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-methylphenyl)urea (PubChem CID 118591686) has the molecular formula C22H27N9O2 and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-[5-[6-[[3-(diaminomethylideneamino)propylamino]methyl]-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[5-[6-[[3-(diaminomethylideneamino)propylamino]methyl]-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 118591686 |
| Molecular Formula | C22H27N9O2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-[5-[6-[[3-(diaminomethylideneamino)propylamino]methyl]-3-pyridinyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ncc(-c2ccc(CNCCCN=C(N)N)nc2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H27N9O2/c1-14-5-2-3-6-18(14)29-22(33)31-21-28-13-17(19(32)30-21)15-7-8-16(27-11-15)12-25-9-4-10-26-20(23)24/h2-3,5-8,11,13,25H,4,9-10,12H2,1H3,(H4,23,24,26)(H3,28,29,30,31,32,33) |
| InChIKey | ZYBNAUZGOIGWSZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 176.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|