C27H36ClN9O2 — CID 66581674
1-[5-[4-[[3-aminopropyl-[3-(diaminomethylideneamino)propyl]amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(3-chlorophenyl)ethyl]urea (PubChem CID 66581674) has the molecular formula C27H36ClN9O2 and a molecular weight of 554.10 g/mol. Its IUPAC name is 1-[5-[4-[[3-aminopropyl-[3-(diaminomethylideneamino)propyl]amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(3-chlorophenyl)ethyl]urea.
| Compound Name | 1-[5-[4-[[3-aminopropyl-[3-(diaminomethylideneamino)propyl]amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(3-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 66581674 |
| Molecular Formula | C27H36ClN9O2 |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 1-[5-[4-[[3-aminopropyl-[3-(diaminomethylideneamino)propyl]amino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(3-chlorophenyl)ethyl]urea |
| SMILES | NCCCN(CCCN=C(N)N)Cc1ccc(-c2cnc(NC(=O)NCCc3cccc(Cl)c3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H36ClN9O2/c28-22-5-1-4-19(16-22)10-13-33-27(39)36-26-34-17-23(24(38)35-26)21-8-6-20(7-9-21)18-37(14-2-11-29)15-3-12-32-25(30)31/h1,4-9,16-17H,2-3,10-15,18,29H2,(H4,30,31,32)(H3,33,34,35,36,38,39) |
| InChIKey | POUPHRFPTRPAGS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|