C25H34N10O — CID 118857137
5-[4-[[3-aminopropyl-[3-(diaminomethylamino)propyl]amino]methyl]phenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 118857137) has the molecular formula C25H34N10O and a molecular weight of 490.62 g/mol. Its IUPAC name is 5-[4-[[3-aminopropyl-[3-(diaminomethylamino)propyl]amino]methyl]phenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-[[3-aminopropyl-[3-(diaminomethylamino)propyl]amino]methyl]phenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 118857137 |
| Molecular Formula | C25H34N10O |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 5-[4-[[3-aminopropyl-[3-(diaminomethylamino)propyl]amino]methyl]phenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | NCCCN(CCCNC(N)N)Cc1ccc(-c2cnc(Nc3nc4ccccc4[nH]3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H34N10O/c26-11-3-13-35(14-4-12-29-23(27)28)16-17-7-9-18(10-8-17)19-15-30-24(33-22(19)36)34-25-31-20-5-1-2-6-21(20)32-25/h1-2,5-10,15,23,29H,3-4,11-14,16,26-28H2,(H3,30,31,32,33,34,36) |
| InChIKey | GUKJWVVYUFMLNF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 179.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|