C21H22FN7O — CID 66581434
5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 66581434) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66581434 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-2-(1H-benzimidazol-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | NCCCNCc1ccc(-c2cnc(Nc3nc4ccccc4[nH]3)[nH]c2=O)c(F)c1 |
| InChI | InChI=1S/C21H22FN7O/c22-16-10-13(11-24-9-3-8-23)6-7-14(16)15-12-25-20(28-19(15)30)29-21-26-17-4-1-2-5-18(17)27-21/h1-2,4-7,10,12,24H,3,8-9,11,23H2,(H3,25,26,27,28,29,30) |
| InChIKey | YFPAVFWKEZFSPD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|