C26H23F3N6O2 — CID 66581482
1-[6-oxo-5-[4-[(3-pyridin-3-ylpropylamino)methyl]phenyl]-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 66581482) has the molecular formula C26H23F3N6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-[6-oxo-5-[4-[(3-pyridin-3-ylpropylamino)methyl]phenyl]-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[6-oxo-5-[4-[(3-pyridin-3-ylpropylamino)methyl]phenyl]-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 66581482 |
| Molecular Formula | C26H23F3N6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 1-[6-oxo-5-[4-[(3-pyridin-3-ylpropylamino)methyl]phenyl]-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ncc(-c2ccc(CNCCCc3cccnc3)cc2)c(=O)[nH]1)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H23F3N6O2/c27-20-11-22(29)23(12-21(20)28)33-26(37)35-25-32-15-19(24(36)34-25)18-7-5-17(6-8-18)14-31-10-2-4-16-3-1-9-30-13-16/h1,3,5-9,11-13,15,31H,2,4,10,14H2,(H3,32,33,34,35,36,37) |
| InChIKey | YCQBVSDEUOJWNA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|