C21H20ClF2N5O2 — CID 140947569
1-[5-[3-chloro-4-[(3-fluoropropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(3-fluorophenyl)urea (PubChem CID 140947569) has the molecular formula C21H20ClF2N5O2 and a molecular weight of 447.87 g/mol. Its IUPAC name is 1-[5-[3-chloro-4-[(3-fluoropropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[5-[3-chloro-4-[(3-fluoropropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 140947569 |
| Molecular Formula | C21H20ClF2N5O2 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-[5-[3-chloro-4-[(3-fluoropropylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1ncc(-c2ccc(CNCCCF)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C21H20ClF2N5O2/c22-18-9-13(5-6-14(18)11-25-8-2-7-23)17-12-26-20(28-19(17)30)29-21(31)27-16-4-1-3-15(24)10-16/h1,3-6,9-10,12,25H,2,7-8,11H2,(H3,26,27,28,29,30,31) |
| InChIKey | XGPPBJQHJHYIQJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|