C24H28ClFN6O2 — CID 118591561
1-[5-[4-[(3-aminopropylamino)methyl]-3-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2-chloro-4-methylphenyl)ethyl]urea (PubChem CID 118591561) has the molecular formula C24H28ClFN6O2 and a molecular weight of 486.98 g/mol. Its IUPAC name is 1-[5-[4-[(3-aminopropylamino)methyl]-3-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2-chloro-4-methylphenyl)ethyl]urea.
| Compound Name | 1-[5-[4-[(3-aminopropylamino)methyl]-3-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2-chloro-4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 118591561 |
| Molecular Formula | C24H28ClFN6O2 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-[5-[4-[(3-aminopropylamino)methyl]-3-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2-chloro-4-methylphenyl)ethyl]urea |
| SMILES | Cc1ccc(CCNC(=O)Nc2ncc(-c3ccc(CNCCCN)c(F)c3)c(=O)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C24H28ClFN6O2/c1-15-3-4-16(20(25)11-15)7-10-29-24(34)32-23-30-14-19(22(33)31-23)17-5-6-18(21(26)12-17)13-28-9-2-8-27/h3-6,11-12,14,28H,2,7-10,13,27H2,1H3,(H3,29,30,31,32,33,34) |
| InChIKey | SNORCBWTTTUUMQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|