C22H23ClFN5O3S — CID 118591787
1-[5-[3-chloro-4-[(2-methylsulfanylethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea (PubChem CID 118591787) has the molecular formula C22H23ClFN5O3S and a molecular weight of 491.98 g/mol. Its IUPAC name is 1-[5-[3-chloro-4-[(2-methylsulfanylethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea.
| Compound Name | 1-[5-[3-chloro-4-[(2-methylsulfanylethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 118591787 |
| Molecular Formula | C22H23ClFN5O3S |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[5-[3-chloro-4-[(2-methylsulfanylethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea |
| SMILES | CSCCNCc1ccc(-c2cnc(NC(=O)Nc3ccccc3OCF)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C22H23ClFN5O3S/c1-33-9-8-25-11-15-7-6-14(10-17(15)23)16-12-26-21(28-20(16)30)29-22(31)27-18-4-2-3-5-19(18)32-13-24/h2-7,10,12,25H,8-9,11,13H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | KSWNZLDFANBRJL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|