C23H22F3N5O5 — CID 66581679
4-[[4-[6-oxo-2-[[2-(trifluoromethoxy)phenyl]carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid (PubChem CID 66581679) has the molecular formula C23H22F3N5O5 and a molecular weight of 505.45 g/mol. Its IUPAC name is 4-[[4-[6-oxo-2-[[2-(trifluoromethoxy)phenyl]carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-[6-oxo-2-[[2-(trifluoromethoxy)phenyl]carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 66581679 |
| Molecular Formula | C23H22F3N5O5 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 4-[[4-[6-oxo-2-[[2-(trifluoromethoxy)phenyl]carbamoylamino]-1H-pyrimidin-5-yl]phenyl]methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1ccc(-c2cnc(NC(=O)Nc3ccccc3OC(F)(F)F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H22F3N5O5/c24-23(25,26)36-18-5-2-1-4-17(18)29-22(35)31-21-28-13-16(20(34)30-21)15-9-7-14(8-10-15)12-27-11-3-6-19(32)33/h1-2,4-5,7-10,13,27H,3,6,11-12H2,(H,32,33)(H3,28,29,30,31,34,35) |
| InChIKey | DFYVBFMAWHUZOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|