C33H49F2N9O3 — CID 161273873
1-[2-(3-amino-2,2-difluoropropoxy)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 161273873) has the molecular formula C33H49F2N9O3 and a molecular weight of 657.81 g/mol. Its IUPAC name is 1-[2-(3-amino-2,2-difluoropropoxy)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 1-[2-(3-amino-2,2-difluoropropoxy)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 161273873 |
| Molecular Formula | C33H49F2N9O3 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.39 |
| IUPAC Name | 1-[2-(3-amino-2,2-difluoropropoxy)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)NC(=O)Nc1ccccc1OCC(F)(F)CN.CC(C)(C)c1ncc(-c2ccc(CNCCCN=C(N)N)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H28N6O.C14H21F2N3O2/c1-19(2,3)17-24-12-15(16(26)25-17)14-7-5-13(6-8-14)11-22-9-4-10-23-18(20)21;1-13(2,3)19-12(20)18-10-6-4-5-7-11(10)21-9-14(15,16)8-17/h5-8,12,22H,4,9-11H2,1-3H3,(H4,20,21,23)(H,24,25,26);4-7H,8-9,17H2,1-3H3,(H2,18,19,20) |
| InChIKey | VEEJNSOLRQKALP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|